C34H43ClN4O2Si — CID 67703234
1-[5-(2-chlorophenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 67703234) has the molecular formula C34H43ClN4O2Si and a molecular weight of 603.28 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[5-(2-chlorophenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 67703234 |
| Molecular Formula | C34H43ClN4O2Si |
| Molecular Weight | 603.28 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 1-[5-(2-chlorophenyl)-2-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1nc(-c2ccccc2)n(COCC[Si](C)(C)C)c1-c1ccccc1Cl |
| InChI | InChI=1S/C34H43ClN4O2Si/c1-23(2)26-17-13-18-27(24(3)4)30(26)36-34(40)38-32-31(28-16-11-12-19-29(28)35)39(22-41-20-21-42(5,6)7)33(37-32)25-14-9-8-10-15-25/h8-19,23-24H,20-22H2,1-7H3,(H2,36,38,40) |
| InChIKey | ARRQKIQBLODFEV-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.28 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|