C25H31BrClN3O3Si — CID 71267041
[(1R)-1-(2-chlorophenyl)ethyl] N-[3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate (PubChem CID 71267041) has the molecular formula C25H31BrClN3O3Si and a molecular weight of 564.98 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-[3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 71267041 |
| Molecular Formula | C25H31BrClN3O3Si |
| Molecular Weight | 564.98 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]carbamate |
| SMILES | Cc1c(NC(=O)O[C@H](C)c2ccccc2Cl)c(-c2ccc(Br)cc2)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H31BrClN3O3Si/c1-17-23(28-25(31)33-18(2)21-8-6-7-9-22(21)27)24(19-10-12-20(26)13-11-19)29-30(17)16-32-14-15-34(3,4)5/h6-13,18H,14-16H2,1-5H3,(H,28,31)/t18-/m1/s1 |
| InChIKey | CBPVJGFJQODZHT-GOSISDBHSA-N |
| XLogP | 7.90 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.98 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|