C40H43ClN2O5Si — CID 71265724
methyl 1-[4-[4-[3-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]-1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]phenyl]cyclopropane-1-carboxylate (PubChem CID 71265724) has the molecular formula C40H43ClN2O5Si and a molecular weight of 695.33 g/mol. Its IUPAC name is methyl 1-[4-[4-[3-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]-1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]phenyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[4-[4-[3-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]-1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71265724 |
| Molecular Formula | C40H43ClN2O5Si |
| Molecular Weight | 695.33 g/mol |
| Exact Mass | 694.26 |
| IUPAC Name | methyl 1-[4-[4-[3-[[(1R)-1-(2-chlorophenyl)ethoxy]carbonylamino]-1-(2-trimethylsilylethoxymethyl)indol-2-yl]phenyl]phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(-c3ccc(-c4c(NC(=O)O[C@H](C)c5ccccc5Cl)c5ccccc5n4COCC[Si](C)(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C40H43ClN2O5Si/c1-27(32-10-6-8-12-34(32)41)48-39(45)42-36-33-11-7-9-13-35(33)43(26-47-24-25-49(3,4)5)37(36)30-16-14-28(15-17-30)29-18-20-31(21-19-29)40(22-23-40)38(44)46-2/h6-21,27H,22-26H2,1-5H3,(H,42,45)/t27-/m1/s1 |
| InChIKey | NQSOFPGJNWQXHF-HHHXNRCGSA-N |
| XLogP | 10.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.33 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|