C23H17BrClNO3 — CID 71266369
[(1R)-1-(2-chlorophenyl)ethyl] N-[2-(4-bromophenyl)-1-benzofuran-3-yl]carbamate (PubChem CID 71266369) has the molecular formula C23H17BrClNO3 and a molecular weight of 470.75 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-[2-(4-bromophenyl)-1-benzofuran-3-yl]carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[2-(4-bromophenyl)-1-benzofuran-3-yl]carbamate |
|---|---|
| PubChem CID | 71266369 |
| Molecular Formula | C23H17BrClNO3 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[2-(4-bromophenyl)-1-benzofuran-3-yl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1c(-c2ccc(Br)cc2)oc2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C23H17BrClNO3/c1-14(17-6-2-4-8-19(17)25)28-23(27)26-21-18-7-3-5-9-20(18)29-22(21)15-10-12-16(24)13-11-15/h2-14H,1H3,(H,26,27)/t14-/m1/s1 |
| InChIKey | UGXOKUXICBVIPK-CQSZACIVSA-N |
| XLogP | 7.83 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |