C18H14BrCl2N3O2 — CID 153378753
[(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-bromophenyl)-4-chloropyrazol-5-yl]carbamate (PubChem CID 153378753) has the molecular formula C18H14BrCl2N3O2 and a molecular weight of 455.14 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-bromophenyl)-4-chloropyrazol-5-yl]carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-bromophenyl)-4-chloropyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 153378753 |
| Molecular Formula | C18H14BrCl2N3O2 |
| Molecular Weight | 455.14 g/mol |
| Exact Mass | 452.96 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-bromophenyl)-4-chloropyrazol-5-yl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1c(Cl)cnn1-c1ccc(Br)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H14BrCl2N3O2/c1-11(14-4-2-3-5-15(14)20)26-18(25)23-17-16(21)10-22-24(17)13-8-6-12(19)7-9-13/h2-11H,1H3,(H,23,25)/t11-/m1/s1 |
| InChIKey | MTOFZIVSDKZBLH-LLVKDONJSA-N |
| XLogP | 6.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.14 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |