C21H23ClN4O4 — CID 175909953
[(1R)-1-(2-chlorophenyl)ethyl] N-[4-[5-(methoxymethoxy)-6-methyl-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate (PubChem CID 175909953) has the molecular formula C21H23ClN4O4 and a molecular weight of 430.89 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-[4-[5-(methoxymethoxy)-6-methyl-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[4-[5-(methoxymethoxy)-6-methyl-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 175909953 |
| Molecular Formula | C21H23ClN4O4 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[4-[5-(methoxymethoxy)-6-methyl-2-pyridinyl]-1-methylpyrazol-5-yl]carbamate |
| SMILES | COCOc1ccc(-c2cnn(C)c2NC(=O)O[C@H](C)c2ccccc2Cl)nc1C |
| InChI | InChI=1S/C21H23ClN4O4/c1-13-19(29-12-28-4)10-9-18(24-13)16-11-23-26(3)20(16)25-21(27)30-14(2)15-7-5-6-8-17(15)22/h5-11,14H,12H2,1-4H3,(H,25,27)/t14-/m1/s1 |
| InChIKey | JKJKGKUGLZUDCZ-CQSZACIVSA-N |
| XLogP | 4.74 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|