C20H17ClN4O2 — CID 90428534
[(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-cyanophenyl)-4-methylpyrazol-5-yl]carbamate (PubChem CID 90428534) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-cyanophenyl)-4-methylpyrazol-5-yl]carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-cyanophenyl)-4-methylpyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 90428534 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[1-(4-cyanophenyl)-4-methylpyrazol-5-yl]carbamate |
| SMILES | Cc1cnn(-c2ccc(C#N)cc2)c1NC(=O)O[C@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN4O2/c1-13-12-23-25(16-9-7-15(11-22)8-10-16)19(13)24-20(26)27-14(2)17-5-3-4-6-18(17)21/h3-10,12,14H,1-2H3,(H,24,26)/t14-/m1/s1 |
| InChIKey | OJUKOLDXTCBRHK-CQSZACIVSA-N |
| XLogP | 5.02 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |