C28H32N4O4 — CID 175138586
[1-[4-[4-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]phenyl]piperidin-4-yl] cyclopropanecarboxylate (PubChem CID 175138586) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is [1-[4-[4-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]phenyl]piperidin-4-yl] cyclopropanecarboxylate.
| Compound Name | [1-[4-[4-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]phenyl]piperidin-4-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175138586 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [1-[4-[4-methyl-5-(1-phenylethoxycarbonylamino)pyrazol-1-yl]phenyl]piperidin-4-yl] cyclopropanecarboxylate |
| SMILES | Cc1cnn(-c2ccc(N3CCC(OC(=O)C4CC4)CC3)cc2)c1NC(=O)OC(C)c1ccccc1 |
| InChI | InChI=1S/C28H32N4O4/c1-19-18-29-32(26(19)30-28(34)35-20(2)21-6-4-3-5-7-21)24-12-10-23(11-13-24)31-16-14-25(15-17-31)36-27(33)22-8-9-22/h3-7,10-13,18,20,22,25H,8-9,14-17H2,1-2H3,(H,30,34) |
| InChIKey | MHAKKWSWWNOFSN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|