C22H22ClN3O4 — CID 70856237
ethyl 2-chloro-5-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]benzoate (PubChem CID 70856237) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is ethyl 2-chloro-5-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]benzoate |
|---|---|
| PubChem CID | 70856237 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | ethyl 2-chloro-5-[1-methyl-5-[[(1R)-1-phenylethoxy]carbonylamino]pyrazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2cnn(C)c2NC(=O)O[C@H](C)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H22ClN3O4/c1-4-29-21(27)17-12-16(10-11-19(17)23)18-13-24-26(3)20(18)25-22(28)30-14(2)15-8-6-5-7-9-15/h5-14H,4H2,1-3H3,(H,25,28)/t14-/m1/s1 |
| InChIKey | XHJQOHLJCFBJAA-CQSZACIVSA-N |
| XLogP | 5.23 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |