C18H25BrN2O3Si — CID 71267034
methyl 3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate (PubChem CID 71267034) has the molecular formula C18H25BrN2O3Si and a molecular weight of 425.40 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate.
| Compound Name | methyl 3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71267034 |
| Molecular Formula | C18H25BrN2O3Si |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | methyl 3-(4-bromophenyl)-5-methyl-1-(2-trimethylsilylethoxymethyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)nn(COCC[Si](C)(C)C)c1C |
| InChI | InChI=1S/C18H25BrN2O3Si/c1-13-16(18(22)23-2)17(14-6-8-15(19)9-7-14)20-21(13)12-24-10-11-25(3,4)5/h6-9H,10-12H2,1-5H3 |
| InChIKey | ZZXQCWWETNVWOV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|