C22H23ClN2O3 — CID 113201411
2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 113201411) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 113201411 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-(4-chloro-1,3-dioxoisoindol-2-yl)-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CN1C(=O)c2cccc(Cl)c2C1=O |
| InChI | InChI=1S/C22H23ClN2O3/c1-12(2)14-7-5-8-15(13(3)4)20(14)24-18(26)11-25-21(27)16-9-6-10-17(23)19(16)22(25)28/h5-10,12-13H,11H2,1-4H3,(H,24,26) |
| InChIKey | QRSMGWPVFFTJME-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|