C26H22N2O4 — CID 3271634
ethyl 2-[2-(1,3-benzodioxol-5-yl)-4,5-diphenylimidazol-1-yl]acetate (PubChem CID 3271634) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-benzodioxol-5-yl)-4,5-diphenylimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[2-(1,3-benzodioxol-5-yl)-4,5-diphenylimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 3271634 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | ethyl 2-[2-(1,3-benzodioxol-5-yl)-4,5-diphenylimidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(-c2ccc3c(c2)OCO3)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H22N2O4/c1-2-30-23(29)16-28-25(19-11-7-4-8-12-19)24(18-9-5-3-6-10-18)27-26(28)20-13-14-21-22(15-20)32-17-31-21/h3-15H,2,16-17H2,1H3 |
| InChIKey | SUKQACOQGCOPQD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |