C24H21N3O3 — CID 101126103
2-(1,3-benzodioxol-5-yl)-3-benzyl-N-ethylbenzimidazole-5-carboxamide (PubChem CID 101126103) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-3-benzyl-N-ethylbenzimidazole-5-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-3-benzyl-N-ethylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 101126103 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-3-benzyl-N-ethylbenzimidazole-5-carboxamide |
| SMILES | CCNC(=O)c1ccc2nc(-c3ccc4c(c3)OCO4)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C24H21N3O3/c1-2-25-24(28)18-8-10-19-20(12-18)27(14-16-6-4-3-5-7-16)23(26-19)17-9-11-21-22(13-17)30-15-29-21/h3-13H,2,14-15H2,1H3,(H,25,28) |
| InChIKey | KKKCKMVZTOSBJT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |