C23H21Cl2N3O — CID 18680864
N-chloro-2-ethyl-3-[(4-phenylphenyl)methyl]benzimidazole-5-carboxamide;hydrochloride (PubChem CID 18680864) has the molecular formula C23H21Cl2N3O and a molecular weight of 426.35 g/mol. Its IUPAC name is N-chloro-2-ethyl-3-[(4-phenylphenyl)methyl]benzimidazole-5-carboxamide;hydrochloride.
| Compound Name | N-chloro-2-ethyl-3-[(4-phenylphenyl)methyl]benzimidazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 18680864 |
| Molecular Formula | C23H21Cl2N3O |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-chloro-2-ethyl-3-[(4-phenylphenyl)methyl]benzimidazole-5-carboxamide;hydrochloride |
| SMILES | CCc1nc2ccc(C(=O)NCl)cc2n1Cc1ccc(-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C23H20ClN3O.ClH/c1-2-22-25-20-13-12-19(23(28)26-24)14-21(20)27(22)15-16-8-10-18(11-9-16)17-6-4-3-5-7-17;/h3-14H,2,15H2,1H3,(H,26,28);1H |
| InChIKey | HTRVZTZHNPZGBB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|