C28H24N4O — CID 18680974
2-ethyl-3-[(4-phenylphenyl)methyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide (PubChem CID 18680974) has the molecular formula C28H24N4O and a molecular weight of 432.53 g/mol. Its IUPAC name is 2-ethyl-3-[(4-phenylphenyl)methyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide.
| Compound Name | 2-ethyl-3-[(4-phenylphenyl)methyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18680974 |
| Molecular Formula | C28H24N4O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-ethyl-3-[(4-phenylphenyl)methyl]-N-pyridin-3-ylbenzimidazole-5-carboxamide |
| SMILES | CCc1nc2ccc(C(=O)Nc3cccnc3)cc2n1Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24N4O/c1-2-27-31-25-15-14-23(28(33)30-24-9-6-16-29-18-24)17-26(25)32(27)19-20-10-12-22(13-11-20)21-7-4-3-5-8-21/h3-18H,2,19H2,1H3,(H,30,33) |
| InChIKey | QUOGXQVHJOXIEE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |