C26H21N3O3 — CID 122500865
4-methoxy-1-N-(4-phenylphenyl)-3-N-pyridin-3-ylbenzene-1,3-dicarboxamide (PubChem CID 122500865) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-methoxy-1-N-(4-phenylphenyl)-3-N-pyridin-3-ylbenzene-1,3-dicarboxamide.
| Compound Name | 4-methoxy-1-N-(4-phenylphenyl)-3-N-pyridin-3-ylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 122500865 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 4-methoxy-1-N-(4-phenylphenyl)-3-N-pyridin-3-ylbenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3ccccc3)cc2)cc1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C26H21N3O3/c1-32-24-14-11-20(16-23(24)26(31)29-22-8-5-15-27-17-22)25(30)28-21-12-9-19(10-13-21)18-6-3-2-4-7-18/h2-17H,1H3,(H,28,30)(H,29,31) |
| InChIKey | XGUGRDBWAGOPOM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |