C20H18N2O4 — CID 90643074
3,4-dimethoxy-N-(4-pyridin-3-yloxyphenyl)benzamide (PubChem CID 90643074) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(4-pyridin-3-yloxyphenyl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(4-pyridin-3-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 90643074 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3,4-dimethoxy-N-(4-pyridin-3-yloxyphenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Oc3cccnc3)cc2)cc1OC |
| InChI | InChI=1S/C20H18N2O4/c1-24-18-10-5-14(12-19(18)25-2)20(23)22-15-6-8-16(9-7-15)26-17-4-3-11-21-13-17/h3-13H,1-2H3,(H,22,23) |
| InChIKey | CIHVIWFSMBRRSK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |