C14H13BrN2O3 — CID 27165075
4-bromo-3,5-dimethoxy-N-pyridin-3-ylbenzamide (PubChem CID 27165075) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-pyridin-3-ylbenzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 27165075 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-pyridin-3-ylbenzamide |
| SMILES | COc1cc(C(=O)Nc2cccnc2)cc(OC)c1Br |
| InChI | InChI=1S/C14H13BrN2O3/c1-19-11-6-9(7-12(20-2)13(11)15)14(18)17-10-4-3-5-16-8-10/h3-8H,1-2H3,(H,17,18) |
| InChIKey | LFWLFWQDZZLKBG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |