C17H16N2O3 — CID 82149522
3-[2-(1,3-benzodioxol-5-yl)benzimidazol-1-yl]propan-1-ol (PubChem CID 82149522) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yl)benzimidazol-1-yl]propan-1-ol.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yl)benzimidazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 82149522 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yl)benzimidazol-1-yl]propan-1-ol |
| SMILES | OCCCn1c(-c2ccc3c(c2)OCO3)nc2ccccc21 |
| InChI | InChI=1S/C17H16N2O3/c20-9-3-8-19-14-5-2-1-4-13(14)18-17(19)12-6-7-15-16(10-12)22-11-21-15/h1-2,4-7,10,20H,3,8-9,11H2 |
| InChIKey | JEVDGWRGZGBPGR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |