C16H13F2N3O2 — CID 94750264
2-[2-(1,3-benzodioxol-5-yl)-5,6-difluorobenzimidazol-1-yl]ethanamine (PubChem CID 94750264) has the molecular formula C16H13F2N3O2 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-5,6-difluorobenzimidazol-1-yl]ethanamine.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-5,6-difluorobenzimidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 94750264 |
| Molecular Formula | C16H13F2N3O2 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-5,6-difluorobenzimidazol-1-yl]ethanamine |
| SMILES | NCCn1c(-c2ccc3c(c2)OCO3)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C16H13F2N3O2/c17-10-6-12-13(7-11(10)18)21(4-3-19)16(20-12)9-1-2-14-15(5-9)23-8-22-14/h1-2,5-7H,3-4,8,19H2 |
| InChIKey | PHCOZCWOKZWYGL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |