About 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile
4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile (PubChem CID 82150504) has the molecular formula C18H14FN3O2
and a molecular weight of 323.33 g/mol. Its IUPAC name is 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile.
Molecular Properties
| Compound Name | 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile |
| PubChem CID | 82150504 |
| Molecular Formula | C18H14FN3O2 |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile |
| SMILES | N#CCCCn1c(-c2ccc(F)cc2)nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H14FN3O2/c19-13-5-3-12(4-6-13)18-21-14-9-16-17(24-11-23-16)10-15(14)22(18)8-2-1-7-20/h3-6,9-10H,1-2,8,11H2 |
| InChIKey | TXJOZJZROOEQAN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile?
The IUPAC name of 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile (CID 82150504) is 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile.
What is the SMILES notation for 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile?
The canonical SMILES for 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile is N#CCCCn1c(-c2ccc(F)cc2)nc2cc3c(cc21)OCO3.
What is the InChIKey of 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile?
The InChIKey is TXJOZJZROOEQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN3O2/c19-13-5-3-12(4-6-13)18-21-14-9-16-17(24-11-23-16)10-15(14)22(18)8-2-1-7-20/h3-6,9-10H,1-2,8,11H2.
What are the key properties of 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile?
4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile has a molecular weight of 323.33 g/mol, XLogP of 3.87, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(4-fluorophenyl)-[1,3]dioxolo[4,5-f]benzimidazol-7-yl]butanenitrile is sourced from PubChem (CID 82150504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).