C15H15N3O2 — CID 82150499
4-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butanenitrile (PubChem CID 82150499) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butanenitrile.
| Compound Name | 4-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butanenitrile |
|---|---|
| PubChem CID | 82150499 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(6-cyclopropyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)butanenitrile |
| SMILES | N#CCCCn1c(C2CC2)nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C15H15N3O2/c16-5-1-2-6-18-12-8-14-13(19-9-20-14)7-11(12)17-15(18)10-3-4-10/h7-8,10H,1-4,6,9H2 |
| InChIKey | LSRZVGZPSDAMIF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|