C16H19N3 — CID 82150457
4-(2-cyclopropyl-5,6-dimethylbenzimidazol-1-yl)butanenitrile (PubChem CID 82150457) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-(2-cyclopropyl-5,6-dimethylbenzimidazol-1-yl)butanenitrile.
| Compound Name | 4-(2-cyclopropyl-5,6-dimethylbenzimidazol-1-yl)butanenitrile |
|---|---|
| PubChem CID | 82150457 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 4-(2-cyclopropyl-5,6-dimethylbenzimidazol-1-yl)butanenitrile |
| SMILES | Cc1cc2nc(C3CC3)n(CCCC#N)c2cc1C |
| InChI | InChI=1S/C16H19N3/c1-11-9-14-15(10-12(11)2)19(8-4-3-7-17)16(18-14)13-5-6-13/h9-10,13H,3-6,8H2,1-2H3 |
| InChIKey | GBECDHCDTVIZIA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|