C19H17F2N3 — CID 82150475
4-[2-(3,4-difluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butanenitrile (PubChem CID 82150475) has the molecular formula C19H17F2N3 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-[2-(3,4-difluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[2-(3,4-difluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 82150475 |
| Molecular Formula | C19H17F2N3 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-[2-(3,4-difluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butanenitrile |
| SMILES | Cc1cc2nc(-c3ccc(F)c(F)c3)n(CCCC#N)c2cc1C |
| InChI | InChI=1S/C19H17F2N3/c1-12-9-17-18(10-13(12)2)24(8-4-3-7-22)19(23-17)14-5-6-15(20)16(21)11-14/h5-6,9-11H,3-4,8H2,1-2H3 |
| InChIKey | NFWVOCZAOSTEKG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|