C19H22FN3 — CID 94748001
4-[2-(4-fluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butan-1-amine (PubChem CID 94748001) has the molecular formula C19H22FN3 and a molecular weight of 311.40 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butan-1-amine.
| Compound Name | 4-[2-(4-fluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 94748001 |
| Molecular Formula | C19H22FN3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-5,6-dimethylbenzimidazol-1-yl]butan-1-amine |
| SMILES | Cc1cc2nc(-c3ccc(F)cc3)n(CCCCN)c2cc1C |
| InChI | InChI=1S/C19H22FN3/c1-13-11-17-18(12-14(13)2)23(10-4-3-9-21)19(22-17)15-5-7-16(20)8-6-15/h5-8,11-12H,3-4,9-10,21H2,1-2H3 |
| InChIKey | RTMTUOPIVNTPDG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|