C17H18F2N4 — CID 94750354
5-[1-(3-aminopropyl)-5,6-difluorobenzimidazol-2-yl]-2-methylaniline (PubChem CID 94750354) has the molecular formula C17H18F2N4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 5-[1-(3-aminopropyl)-5,6-difluorobenzimidazol-2-yl]-2-methylaniline.
| Compound Name | 5-[1-(3-aminopropyl)-5,6-difluorobenzimidazol-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 94750354 |
| Molecular Formula | C17H18F2N4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 5-[1-(3-aminopropyl)-5,6-difluorobenzimidazol-2-yl]-2-methylaniline |
| SMILES | Cc1ccc(-c2nc3cc(F)c(F)cc3n2CCCN)cc1N |
| InChI | InChI=1S/C17H18F2N4/c1-10-3-4-11(7-14(10)21)17-22-15-8-12(18)13(19)9-16(15)23(17)6-2-5-20/h3-4,7-9H,2,5-6,20-21H2,1H3 |
| InChIKey | TVZLOISDGJYQNH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|