C17H12F3N3 — CID 94757427
4-[5,6-difluoro-2-(2-fluorophenyl)benzimidazol-1-yl]butanenitrile (PubChem CID 94757427) has the molecular formula C17H12F3N3 and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-[5,6-difluoro-2-(2-fluorophenyl)benzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[5,6-difluoro-2-(2-fluorophenyl)benzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 94757427 |
| Molecular Formula | C17H12F3N3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-[5,6-difluoro-2-(2-fluorophenyl)benzimidazol-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(-c2ccccc2F)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C17H12F3N3/c18-12-6-2-1-5-11(12)17-22-15-9-13(19)14(20)10-16(15)23(17)8-4-3-7-21/h1-2,5-6,9-10H,3-4,8H2 |
| InChIKey | YCTZUCDADAFXCQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|