C18H15N3O2 — CID 82145710
3-(6-benzyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanenitrile (PubChem CID 82145710) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-(6-benzyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanenitrile.
| Compound Name | 3-(6-benzyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanenitrile |
|---|---|
| PubChem CID | 82145710 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(6-benzyl-[1,3]dioxolo[4,5-f]benzimidazol-7-yl)propanenitrile |
| SMILES | N#CCCn1c(Cc2ccccc2)nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C18H15N3O2/c19-7-4-8-21-15-11-17-16(22-12-23-17)10-14(15)20-18(21)9-13-5-2-1-3-6-13/h1-3,5-6,10-11H,4,8-9,12H2 |
| InChIKey | BOTNAFSXQDPZEZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |