C23H27N3O3S — CID 18291460
N-(1,3-benzodioxol-5-yl)-2-(1-hexylbenzimidazol-2-yl)sulfanylpropanamide (PubChem CID 18291460) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(1-hexylbenzimidazol-2-yl)sulfanylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(1-hexylbenzimidazol-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 18291460 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(1-hexylbenzimidazol-2-yl)sulfanylpropanamide |
| SMILES | CCCCCCn1c(SC(C)C(=O)Nc2ccc3c(c2)OCO3)nc2ccccc21 |
| InChI | InChI=1S/C23H27N3O3S/c1-3-4-5-8-13-26-19-10-7-6-9-18(19)25-23(26)30-16(2)22(27)24-17-11-12-20-21(14-17)29-15-28-20/h6-7,9-12,14,16H,3-5,8,13,15H2,1-2H3,(H,24,27) |
| InChIKey | ZSJIGUBLKBRNNX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|