C23H20N4O2 — CID 171053517
2-[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]acetohydrazide (PubChem CID 171053517) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]acetohydrazide.
| Compound Name | 2-[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 171053517 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]acetohydrazide |
| SMILES | NNC(=O)Cn1c(-c2ccc(O)cc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H20N4O2/c24-26-20(29)15-27-22(17-9-5-2-6-10-17)21(16-7-3-1-4-8-16)25-23(27)18-11-13-19(28)14-12-18/h1-14,28H,15,24H2,(H,26,29) |
| InChIKey | HHYWDWAGDIOJPZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|