C16H22BrNOSi — CID 141389098
2-[(2-bromo-5-phenylpyrrol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 141389098) has the molecular formula C16H22BrNOSi and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-[(2-bromo-5-phenylpyrrol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(2-bromo-5-phenylpyrrol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 141389098 |
| Molecular Formula | C16H22BrNOSi |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-[(2-bromo-5-phenylpyrrol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c(Br)ccc1-c1ccccc1 |
| InChI | InChI=1S/C16H22BrNOSi/c1-20(2,3)12-11-19-13-18-15(9-10-16(18)17)14-7-5-4-6-8-14/h4-10H,11-13H2,1-3H3 |
| InChIKey | RQUXXLPOPMGLHI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|