C22H26N2O4Si — CID 162469151
5-(3-phenoxyphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid (PubChem CID 162469151) has the molecular formula C22H26N2O4Si and a molecular weight of 410.55 g/mol. Its IUPAC name is 5-(3-phenoxyphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid.
| Compound Name | 5-(3-phenoxyphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 162469151 |
| Molecular Formula | C22H26N2O4Si |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 5-(3-phenoxyphenyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cccc(Oc3ccccc3)c2)cnc1C(=O)O |
| InChI | InChI=1S/C22H26N2O4Si/c1-29(2,3)13-12-27-16-24-20(15-23-21(24)22(25)26)17-8-7-11-19(14-17)28-18-9-5-4-6-10-18/h4-11,14-15H,12-13,16H2,1-3H3,(H,25,26) |
| InChIKey | LXYBJGUMLJXNDU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|