C26H25N3O6 — CID 163327777
5-(3-methoxyphenyl)-1-methyl-N-[(3-phenoxyphenyl)methyl]imidazol-2-amine;oxalic acid (PubChem CID 163327777) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-1-methyl-N-[(3-phenoxyphenyl)methyl]imidazol-2-amine;oxalic acid.
| Compound Name | 5-(3-methoxyphenyl)-1-methyl-N-[(3-phenoxyphenyl)methyl]imidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163327777 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 5-(3-methoxyphenyl)-1-methyl-N-[(3-phenoxyphenyl)methyl]imidazol-2-amine;oxalic acid |
| SMILES | COc1cccc(-c2cnc(NCc3cccc(Oc4ccccc4)c3)n2C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H23N3O2.C2H2O4/c1-27-23(19-9-7-12-21(15-19)28-2)17-26-24(27)25-16-18-8-6-13-22(14-18)29-20-10-4-3-5-11-20;3-1(4)2(5)6/h3-15,17H,16H2,1-2H3,(H,25,26);(H,3,4)(H,5,6) |
| InChIKey | YBPQNHSECZLDAU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|