C21H23N3O6 — CID 126468009
5-(3-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid (PubChem CID 126468009) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid.
| Compound Name | 5-(3-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 126468009 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 5-(3-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid |
| SMILES | COc1cccc(CNc2ncc(-c3cccc(OC)c3)n2C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H21N3O2.C2H2O4/c1-22-18(15-7-5-9-17(11-15)24-3)13-21-19(22)20-12-14-6-4-8-16(10-14)23-2;3-1(4)2(5)6/h4-11,13H,12H2,1-3H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | OIAKWOUIXRRYMF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|