C20H18ClN3O6 — CID 650426
5-(1,3-benzodioxol-5-yl)-N-[(3-chlorophenyl)methyl]-1-methylimidazol-2-amine;oxalic acid (PubChem CID 650426) has the molecular formula C20H18ClN3O6 and a molecular weight of 431.83 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-[(3-chlorophenyl)methyl]-1-methylimidazol-2-amine;oxalic acid.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-[(3-chlorophenyl)methyl]-1-methylimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 650426 |
| Molecular Formula | C20H18ClN3O6 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-[(3-chlorophenyl)methyl]-1-methylimidazol-2-amine;oxalic acid |
| SMILES | Cn1c(-c2ccc3c(c2)OCO3)cnc1NCc1cccc(Cl)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H16ClN3O2.C2H2O4/c1-22-15(13-5-6-16-17(8-13)24-11-23-16)10-21-18(22)20-9-12-3-2-4-14(19)7-12;3-1(4)2(5)6/h2-8,10H,9,11H2,1H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | JVXBLEUHNIZENT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|