C21H22ClN3O4 — CID 163326888
N-[(3-chlorophenyl)methyl]-5-(3,4-dimethylphenyl)-1-methylimidazol-2-amine;oxalic acid (PubChem CID 163326888) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-5-(3,4-dimethylphenyl)-1-methylimidazol-2-amine;oxalic acid.
| Compound Name | N-[(3-chlorophenyl)methyl]-5-(3,4-dimethylphenyl)-1-methylimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163326888 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-5-(3,4-dimethylphenyl)-1-methylimidazol-2-amine;oxalic acid |
| SMILES | Cc1ccc(-c2cnc(NCc3cccc(Cl)c3)n2C)cc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H20ClN3.C2H2O4/c1-13-7-8-16(9-14(13)2)18-12-22-19(23(18)3)21-11-15-5-4-6-17(20)10-15;3-1(4)2(5)6/h4-10,12H,11H2,1-3H3,(H,21,22);(H,3,4)(H,5,6) |
| InChIKey | CCDAXBFVVLKHBK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|