C21H22ClN3O5 — CID 146051212
4-chloro-2-[[[5-(3,4-dimethylphenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid (PubChem CID 146051212) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is 4-chloro-2-[[[5-(3,4-dimethylphenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid.
| Compound Name | 4-chloro-2-[[[5-(3,4-dimethylphenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 146051212 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 4-chloro-2-[[[5-(3,4-dimethylphenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid |
| SMILES | Cc1ccc(-c2cnc(NCc3cc(Cl)ccc3O)n2C)cc1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H20ClN3O.C2H2O4/c1-12-4-5-14(8-13(12)2)17-11-22-19(23(17)3)21-10-15-9-16(20)6-7-18(15)24;3-1(4)2(5)6/h4-9,11,24H,10H2,1-3H3,(H,21,22);(H,3,4)(H,5,6) |
| InChIKey | QGRVMSIKLGOYJN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|