C21H22ClN3O6 — CID 163327411
4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-ethoxyphenol;oxalic acid (PubChem CID 163327411) has the molecular formula C21H22ClN3O6 and a molecular weight of 447.88 g/mol. Its IUPAC name is 4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-ethoxyphenol;oxalic acid.
| Compound Name | 4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-ethoxyphenol;oxalic acid |
|---|---|
| PubChem CID | 163327411 |
| Molecular Formula | C21H22ClN3O6 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-ethoxyphenol;oxalic acid |
| SMILES | CCOc1cc(CNc2ncc(-c3ccc(Cl)cc3)n2C)ccc1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H20ClN3O2.C2H2O4/c1-3-25-18-10-13(4-9-17(18)24)11-21-19-22-12-16(23(19)2)14-5-7-15(20)8-6-14;3-1(4)2(5)6/h4-10,12,24H,3,11H2,1-2H3,(H,21,22);(H,3,4)(H,5,6) |
| InChIKey | YQPHTPOXOQDMHC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|