C27H27N3O6 — CID 163327719
N-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid (PubChem CID 163327719) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163327719 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid |
| SMILES | COc1ccc(CNc2ncc(-c3ccc(-c4ccccc4)cc3)n2C)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H25N3O2.C2H2O4/c1-28-22(21-12-10-20(11-13-21)19-7-5-4-6-8-19)17-27-25(28)26-16-18-9-14-23(29-2)24(15-18)30-3;3-1(4)2(5)6/h4-15,17H,16H2,1-3H3,(H,26,27);(H,3,4)(H,5,6) |
| InChIKey | OWDQWTVAKWMRIE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|