C27H27N3O5 — CID 163327759
N-[(2-ethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid (PubChem CID 163327759) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163327759 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-1-methyl-5-(4-phenylphenyl)imidazol-2-amine;oxalic acid |
| SMILES | CCOc1ccccc1CNc1ncc(-c2ccc(-c3ccccc3)cc2)n1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H25N3O.C2H2O4/c1-3-29-24-12-8-7-11-22(24)17-26-25-27-18-23(28(25)2)21-15-13-20(14-16-21)19-9-5-4-6-10-19;3-1(4)2(5)6/h4-16,18H,3,17H2,1-2H3,(H,26,27);(H,3,4)(H,5,6) |
| InChIKey | VPELFPUVIUDHJE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|