C21H22ClN3O5 — CID 163326908
N-[(2-chlorophenyl)methyl]-5-(4-ethoxyphenyl)-1-methylimidazol-2-amine;oxalic acid (PubChem CID 163326908) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-(4-ethoxyphenyl)-1-methylimidazol-2-amine;oxalic acid.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-(4-ethoxyphenyl)-1-methylimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163326908 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-(4-ethoxyphenyl)-1-methylimidazol-2-amine;oxalic acid |
| SMILES | CCOc1ccc(-c2cnc(NCc3ccccc3Cl)n2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H20ClN3O.C2H2O4/c1-3-24-16-10-8-14(9-11-16)18-13-22-19(23(18)2)21-12-15-6-4-5-7-17(15)20;3-1(4)2(5)6/h4-11,13H,3,12H2,1-2H3,(H,21,22);(H,3,4)(H,5,6) |
| InChIKey | BUILICAZBPDGBG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|