C22H25N3O5 — CID 163326916
5-(4-ethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid (PubChem CID 163326916) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid.
| Compound Name | 5-(4-ethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163326916 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 5-(4-ethoxyphenyl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid |
| SMILES | CCOc1ccc(-c2cnc(NCc3ccc(C)cc3)n2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23N3O.C2H2O4/c1-4-24-18-11-9-17(10-12-18)19-14-22-20(23(19)3)21-13-16-7-5-15(2)6-8-16;3-1(4)2(5)6/h5-12,14H,4,13H2,1-3H3,(H,21,22);(H,3,4)(H,5,6) |
| InChIKey | JOLNEENYWCGZCL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|