C20H17ClN4O4 — CID 163327425
4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]benzonitrile;oxalic acid (PubChem CID 163327425) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is 4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]benzonitrile;oxalic acid.
| Compound Name | 4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]benzonitrile;oxalic acid |
|---|---|
| PubChem CID | 163327425 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]benzonitrile;oxalic acid |
| SMILES | Cn1c(-c2ccc(Cl)cc2)cnc1NCc1ccc(C#N)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H15ClN4.C2H2O4/c1-23-17(15-6-8-16(19)9-7-15)12-22-18(23)21-11-14-4-2-13(10-20)3-5-14;3-1(4)2(5)6/h2-9,12H,11H2,1H3,(H,21,22);(H,3,4)(H,5,6) |
| InChIKey | QGBOGVKKTRVLKQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 128.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|