C27H34ClN3O5 — CID 163327427
2,6-ditert-butyl-4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid (PubChem CID 163327427) has the molecular formula C27H34ClN3O5 and a molecular weight of 516.04 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid.
| Compound Name | 2,6-ditert-butyl-4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 163327427 |
| Molecular Formula | C27H34ClN3O5 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[[[5-(4-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]phenol;oxalic acid |
| SMILES | Cn1c(-c2ccc(Cl)cc2)cnc1NCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H32ClN3O.C2H2O4/c1-24(2,3)19-12-16(13-20(22(19)30)25(4,5)6)14-27-23-28-15-21(29(23)7)17-8-10-18(26)11-9-17;3-1(4)2(5)6/h8-13,15,30H,14H2,1-7H3,(H,27,28);(H,3,4)(H,5,6) |
| InChIKey | XVFPVIHCMCYLNB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|