C21H23N3O4 — CID 163327528
1-methyl-5-(4-methylphenyl)-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid (PubChem CID 163327528) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-methyl-5-(4-methylphenyl)-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid.
| Compound Name | 1-methyl-5-(4-methylphenyl)-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163327528 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-methyl-5-(4-methylphenyl)-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid |
| SMILES | Cc1ccc(CNc2ncc(-c3ccc(C)cc3)n2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H21N3.C2H2O4/c1-14-4-8-16(9-5-14)12-20-19-21-13-18(22(19)3)17-10-6-15(2)7-11-17;3-1(4)2(5)6/h4-11,13H,12H2,1-3H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | QFJOOUKDVUREEB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|