C23H27N3O4 — CID 163326874
5-(3,4-dimethylphenyl)-N-[(4-ethylphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid (PubChem CID 163326874) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-[(4-ethylphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid.
| Compound Name | 5-(3,4-dimethylphenyl)-N-[(4-ethylphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163326874 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-[(4-ethylphenyl)methyl]-1-methylimidazol-2-amine;oxalic acid |
| SMILES | CCc1ccc(CNc2ncc(-c3ccc(C)c(C)c3)n2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H25N3.C2H2O4/c1-5-17-7-9-18(10-8-17)13-22-21-23-14-20(24(21)4)19-11-6-15(2)16(3)12-19;3-1(4)2(5)6/h6-12,14H,5,13H2,1-4H3,(H,22,23);(H,3,4)(H,5,6) |
| InChIKey | HIPQHCIFWQFLEH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|