C21H21N3O6 — CID 646935
5-(1,3-benzodioxol-5-yl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid (PubChem CID 646935) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 646935 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-1-methyl-N-[(4-methylphenyl)methyl]imidazol-2-amine;oxalic acid |
| SMILES | Cc1ccc(CNc2ncc(-c3ccc4c(c3)OCO4)n2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H19N3O2.C2H2O4/c1-13-3-5-14(6-4-13)10-20-19-21-11-16(22(19)2)15-7-8-17-18(9-15)24-12-23-17;3-1(4)2(5)6/h3-9,11H,10,12H2,1-2H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | VMURYOZQRHOCRB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|