C19H17Cl2N3O4 — CID 163327080
N-[(2,6-dichlorophenyl)methyl]-1-methyl-5-phenylimidazol-2-amine;oxalic acid (PubChem CID 163327080) has the molecular formula C19H17Cl2N3O4 and a molecular weight of 422.27 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-1-methyl-5-phenylimidazol-2-amine;oxalic acid.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-1-methyl-5-phenylimidazol-2-amine;oxalic acid |
|---|---|
| PubChem CID | 163327080 |
| Molecular Formula | C19H17Cl2N3O4 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-1-methyl-5-phenylimidazol-2-amine;oxalic acid |
| SMILES | Cn1c(-c2ccccc2)cnc1NCc1c(Cl)cccc1Cl.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H15Cl2N3.C2H2O4/c1-22-16(12-6-3-2-4-7-12)11-21-17(22)20-10-13-14(18)8-5-9-15(13)19;3-1(4)2(5)6/h2-9,11H,10H2,1H3,(H,20,21);(H,3,4)(H,5,6) |
| InChIKey | NGZFDFAKMINFLL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|