C26H27N3O2 — CID 3657177
N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-1-methyl-5-(4-methylphenyl)imidazol-2-amine (PubChem CID 3657177) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-1-methyl-5-(4-methylphenyl)imidazol-2-amine.
| Compound Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-1-methyl-5-(4-methylphenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 3657177 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-1-methyl-5-(4-methylphenyl)imidazol-2-amine |
| SMILES | COc1cc(CNc2ncc(-c3ccc(C)cc3)n2C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H27N3O2/c1-19-9-12-22(13-10-19)23-17-28-26(29(23)2)27-16-21-11-14-24(25(15-21)30-3)31-18-20-7-5-4-6-8-20/h4-15,17H,16,18H2,1-3H3,(H,27,28) |
| InChIKey | XBHKRZAEJCAGOM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |