C18H18ClN3O2 — CID 3566909
4-[[[5-(3-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-methoxyphenol (PubChem CID 3566909) has the molecular formula C18H18ClN3O2 and a molecular weight of 343.81 g/mol. Its IUPAC name is 4-[[[5-(3-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-methoxyphenol.
| Compound Name | 4-[[[5-(3-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 3566909 |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-[[[5-(3-chlorophenyl)-1-methylimidazol-2-yl]amino]methyl]-2-methoxyphenol |
| SMILES | COc1cc(CNc2ncc(-c3cccc(Cl)c3)n2C)ccc1O |
| InChI | InChI=1S/C18H18ClN3O2/c1-22-15(13-4-3-5-14(19)9-13)11-21-18(22)20-10-12-6-7-16(23)17(8-12)24-2/h3-9,11,23H,10H2,1-2H3,(H,20,21) |
| InChIKey | SWVHDVSCKIQTOP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |